![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
Welcome to the fancy easyname mirror server!
via email: mirror@easynameNOSPAM.com
Find our products under:
Hosting / Domain kaufen / VPS / vServer / Domain
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| README.md | 2024-09-16 23:17 | 1.2K | |
| acrobat.png | 2024-09-16 23:17 | 23K | |
| ex-AF-file.pdf | 2024-09-16 23:17 | 22K | |
| ex-AF-file.tex | 2024-09-16 23:17 | 1.1K | |
| ex-alt-actualtext-luatex.pdf | 2024-09-16 23:17 | 17K | |
| ex-alt-actualtext.pdf | 2024-09-16 23:17 | 34K | |
| ex-alt-actualtext.tex | 2024-09-16 23:17 | 4.0K | |
| ex-attribute-luatex.pdf | 2024-09-16 23:17 | 6.5K | |
| ex-attribute.pdf | 2024-09-16 23:17 | 19K | |
| ex-attribute.tex | 2024-09-16 23:17 | 1.3K | |
| ex-formula-problem-luatex.pdf | 2024-09-16 23:17 | 7.7K | |
| ex-formula-problem.pdf | 2024-09-16 23:17 | 20K | |
| ex-formula-problem.tex | 2024-09-16 23:17 | 950 | |
| ex-list.pdf | 2024-09-16 23:17 | 31K | |
| ex-list.tex | 2024-09-16 23:17 | 1.0K | |
| ex-mc-manual-para-split-obsolete.pdf | 2024-09-16 23:17 | 25K | |
| ex-mc-manual-para-split-obsolete.tex | 2024-09-16 23:17 | 2.1K | |
| ex-patch-sectioning-koma-luatex.pdf | 2024-09-16 23:17 | 18K | |
| ex-softhyphen.pdf | 2024-09-16 23:17 | 19K | |
| ex-softhyphen.tex | 2024-09-16 23:17 | 827 | |
| ex-spaceglyph-listings.pdf | 2024-09-16 23:17 | 16K | |
| ex-spaceglyph-listings.tex | 2024-09-16 23:17 | 700 | |
| ex-structure-obsolete.pdf | 2024-09-16 23:17 | 25K | |
| ex-structure-obsolete.tex | 2024-09-16 23:17 | 1.4K | |
| ex-tagpdf-template.pdf | 2024-09-16 23:17 | 19K | |
| ex-tagpdf-template.tex | 2024-09-16 23:17 | 698 | |
| global-ex.png | 2024-09-16 23:17 | 8.1K | |
| link-figure-input.tex | 2024-09-16 23:17 | 2.0K | |
| pac3.PNG | 2024-09-16 23:17 | 138K | |
| pac2024-report.png | 2024-09-16 23:17 | 59K | |
| pac2024-version.png | 2024-09-16 23:17 | 28K | |
| tagpdf-backend.dtx | 2024-09-16 23:17 | 47K | |
| tagpdf-checks.dtx | 2024-09-16 23:17 | 36K | |
| tagpdf-code.pdf | 2024-09-16 23:17 | 1.2M | |
| tagpdf-code.tex | 2024-09-16 23:17 | 2.4K | |
| tagpdf-data.dtx | 2024-09-16 23:17 | 36K | |
| tagpdf-docelements.tex | 2024-09-16 23:17 | 227 | |
| tagpdf-mc-generic.dtx | 2024-09-16 23:17 | 28K | |
| tagpdf-mc-luacode.dtx | 2024-09-16 23:17 | 16K | |
| tagpdf-mc-shared.dtx | 2024-09-16 23:17 | 16K | |
| tagpdf-roles.dtx | 2024-09-16 23:17 | 45K | |
| tagpdf-space.dtx | 2024-09-16 23:17 | 7.1K | |
| tagpdf-struct.dtx | 2024-09-16 23:17 | 78K | |
| tagpdf-tree.dtx | 2024-09-16 23:17 | 20K | |
| tagpdf-user.dtx | 2024-09-16 23:17 | 43K | |
| tagpdf.bib | 2024-09-16 23:17 | 2.6K | |
| tagpdf.dtx | 2024-09-16 23:17 | 25K | |
| tagpdf.ins | 2024-09-16 23:17 | 3.9K | |
| tagpdf.pdf | 2024-09-16 23:17 | 1.1M | |
| tagpdf.tex | 2024-09-16 23:17 | 130K | |
| tagpdfdocu-patches.sty | 2024-09-16 23:17 | 8.2K | |
| tagpdfsetup-keys.tex | 2024-09-16 23:17 | 4.3K | |